C27H34N6O3S — CID 66977493
ethyl 7-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]heptanoate (PubChem CID 66977493) has the molecular formula C27H34N6O3S and a molecular weight of 522.68 g/mol. Its IUPAC name is ethyl 7-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]heptanoate.
| Compound Name | ethyl 7-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]heptanoate |
|---|---|
| PubChem CID | 66977493 |
| Molecular Formula | C27H34N6O3S |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | ethyl 7-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNCc1cc2nc(-c3cccc4[nH]ncc34)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C27H34N6O3S/c1-2-36-24(34)10-5-3-4-6-11-28-17-19-16-23-25(37-19)27(33-12-14-35-15-13-33)31-26(30-23)20-8-7-9-22-21(20)18-29-32-22/h7-9,16,18,28H,2-6,10-15,17H2,1H3,(H,29,32) |
| InChIKey | CXJDJFMMCPSTFU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|