C25H32N6O2 — CID 66977802
N-[3-[2-[3-(morpholin-4-ylmethyl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide (PubChem CID 66977802) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[3-[2-[3-(morpholin-4-ylmethyl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[2-[3-(morpholin-4-ylmethyl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 66977802 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | N-[3-[2-[3-(morpholin-4-ylmethyl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide |
| SMILES | O=C(NCCCn1ccc2cnc(Nc3cccc(CN4CCOCC4)c3)nc21)C1CCC1 |
| InChI | InChI=1S/C25H32N6O2/c32-24(20-5-2-6-20)26-9-3-10-31-11-8-21-17-27-25(29-23(21)31)28-22-7-1-4-19(16-22)18-30-12-14-33-15-13-30/h1,4,7-8,11,16-17,20H,2-3,5-6,9-10,12-15,18H2,(H,26,32)(H,27,28,29) |
| InChIKey | TWPYVVZZLDOPKE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|