About 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one
4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 66979269) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one |
| PubChem CID | 66979269 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | O=C1C=NC2C=CN=CC2N1 |
| InChI | InChI=1S/C7H7N3O/c11-7-4-9-5-1-2-8-3-6(5)10-7/h1-6H,(H,10,11) |
| InChIKey | CZJYCVNIUHGUBO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one?
The IUPAC name of 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one (CID 66979269) is 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one.
What is the SMILES notation for 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one?
The canonical SMILES for 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one is O=C1C=NC2C=CN=CC2N1.
What is the InChIKey of 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one?
The InChIKey is CZJYCVNIUHGUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c11-7-4-9-5-1-2-8-3-6(5)10-7/h1-6H,(H,10,11).
What are the key properties of 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one?
4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one has a molecular weight of 149.15 g/mol, XLogP of -0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydro-4H-pyrido[3,4-b]pyrazin-3-one is sourced from PubChem (CID 66979269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).