C37H55BrFN7O4Si2 — CID 66980176
tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate (PubChem CID 66980176) has the molecular formula C37H55BrFN7O4Si2 and a molecular weight of 816.97 g/mol. Its IUPAC name is tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66980176 |
| Molecular Formula | C37H55BrFN7O4Si2 |
| Molecular Weight | 816.97 g/mol |
| Exact Mass | 815.30 |
| IUPAC Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nc3c(-c4cnc5ccc(F)cc5c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C37H55BrFN7O4Si2/c1-37(2,3)50-36(47)44-14-12-29(13-15-44)42-33-32(38)35(45(24-48-16-18-51(4,5)6)25-49-17-19-52(7,8)9)46-34(43-33)30(23-41-46)27-20-26-21-28(39)10-11-31(26)40-22-27/h10-11,20-23,29H,12-19,24-25H2,1-9H3,(H,42,43) |
| InChIKey | OYJODBWAXJXRPI-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.97 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|