C40H59BrFN7O4Si2 — CID 66980187
tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-prop-2-enylamino]piperidine-1-carboxylate (PubChem CID 66980187) has the molecular formula C40H59BrFN7O4Si2 and a molecular weight of 857.03 g/mol. Its IUPAC name is tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-prop-2-enylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-prop-2-enylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66980187 |
| Molecular Formula | C40H59BrFN7O4Si2 |
| Molecular Weight | 857.03 g/mol |
| Exact Mass | 855.33 |
| IUPAC Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-prop-2-enylamino]piperidine-1-carboxylate |
| SMILES | C=CCN(c1nc2c(-c3cnc4ccc(F)cc4c3)cnn2c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c1Br)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C40H59BrFN7O4Si2/c1-11-16-48(32-14-17-46(18-15-32)39(50)53-40(2,3)4)37-35(41)38(47(27-51-19-21-54(5,6)7)28-52-20-22-55(8,9)10)49-36(45-37)33(26-44-49)30-23-29-24-31(42)12-13-34(29)43-25-30/h11-13,23-26,32H,1,14-22,27-28H2,2-10H3 |
| InChIKey | ISYVHNQGHWRYHA-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 97.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.03 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|