C36H56FN7O2Si2 — CID 66980203
5-N-(1-tert-butylpiperidin-4-yl)-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 66980203) has the molecular formula C36H56FN7O2Si2 and a molecular weight of 694.06 g/mol. Its IUPAC name is 5-N-(1-tert-butylpiperidin-4-yl)-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 5-N-(1-tert-butylpiperidin-4-yl)-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 66980203 |
| Molecular Formula | C36H56FN7O2Si2 |
| Molecular Weight | 694.06 g/mol |
| Exact Mass | 693.40 |
| IUPAC Name | 5-N-(1-tert-butylpiperidin-4-yl)-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | CC(C)(C)N1CCC(Nc2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc5ccc(F)cc5c4)c3n2)CC1 |
| InChI | InChI=1S/C36H56FN7O2Si2/c1-36(2,3)43-14-12-30(13-15-43)40-33-22-34(42(25-45-16-18-47(4,5)6)26-46-17-19-48(7,8)9)44-35(41-33)31(24-39-44)28-20-27-21-29(37)10-11-32(27)38-23-28/h10-11,20-24,30H,12-19,25-26H2,1-9H3,(H,40,41) |
| InChIKey | GBUPDMHWSYLOOW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.06 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|