C37H56FN7O4Si2 — CID 66980260
tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate (PubChem CID 66980260) has the molecular formula C37H56FN7O4Si2 and a molecular weight of 738.07 g/mol. Its IUPAC name is tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66980260 |
| Molecular Formula | C37H56FN7O4Si2 |
| Molecular Weight | 738.07 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc5ccc(F)cc5c4)c3n2)CC1 |
| InChI | InChI=1S/C37H56FN7O4Si2/c1-37(2,3)49-36(46)43-14-12-30(13-15-43)41-33-22-34(44(25-47-16-18-50(4,5)6)26-48-17-19-51(7,8)9)45-35(42-33)31(24-40-45)28-20-27-21-29(38)10-11-32(27)39-23-28/h10-11,20-24,30H,12-19,25-26H2,1-9H3,(H,41,42) |
| InChIKey | XEDUGTLVSNSLRZ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.07 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|