C38H53N7O4Si2 — CID 66980347
4-[8-[bis(2-trimethylsilylethoxymethyl)amino]-4-(6-phenyl-3-pyridinyl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10-pentaen-13-yl]piperidine-1-carboxylic acid (PubChem CID 66980347) has the molecular formula C38H53N7O4Si2 and a molecular weight of 728.06 g/mol. Its IUPAC name is 4-[8-[bis(2-trimethylsilylethoxymethyl)amino]-4-(6-phenyl-3-pyridinyl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10-pentaen-13-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[8-[bis(2-trimethylsilylethoxymethyl)amino]-4-(6-phenyl-3-pyridinyl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10-pentaen-13-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66980347 |
| Molecular Formula | C38H53N7O4Si2 |
| Molecular Weight | 728.06 g/mol |
| Exact Mass | 727.37 |
| IUPAC Name | 4-[8-[bis(2-trimethylsilylethoxymethyl)amino]-4-(6-phenyl-3-pyridinyl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10-pentaen-13-yl]piperidine-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c2c(nc3c(-c4ccc(-c5ccccc5)nc4)cnn13)N(C1CCN(C(=O)O)CC1)CC=C2 |
| InChI | InChI=1S/C38H53N7O4Si2/c1-50(2,3)23-21-48-27-43(28-49-22-24-51(4,5)6)37-32-13-10-18-44(31-16-19-42(20-17-31)38(46)47)35(32)41-36-33(26-40-45(36)37)30-14-15-34(39-25-30)29-11-8-7-9-12-29/h7-15,25-26,31H,16-24,27-28H2,1-6H3,(H,46,47) |
| InChIKey | WSVOHOQOKWWDGS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.06 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|