About 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid
4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 66980674) has the molecular formula C8H5FN2O2
and a molecular weight of 180.14 g/mol. Its IUPAC name is 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid |
| PubChem CID | 66980674 |
| Molecular Formula | C8H5FN2O2 |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnn2cccc(F)c12 |
| InChI | InChI=1S/C8H5FN2O2/c9-6-2-1-3-11-7(6)5(4-10-11)8(12)13/h1-4H,(H,12,13) |
| InChIKey | AVPPBDMVCVKCJQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The IUPAC name of 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid (CID 66980674) is 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The canonical SMILES for 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid is O=C(O)c1cnn2cccc(F)c12.
What is the InChIKey of 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid?
The InChIKey is AVPPBDMVCVKCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O2/c9-6-2-1-3-11-7(6)5(4-10-11)8(12)13/h1-4H,(H,12,13).
What are the key properties of 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid?
4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid has a molecular weight of 180.14 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 66980674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).