About 2H-1,3-thiazole-3-carboxamide;hydrochloride
2H-1,3-thiazole-3-carboxamide;hydrochloride (PubChem CID 66980831) has the molecular formula C4H7ClN2OS
and a molecular weight of 166.63 g/mol. Its IUPAC name is 2H-1,3-thiazole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 2H-1,3-thiazole-3-carboxamide;hydrochloride |
| PubChem CID | 66980831 |
| Molecular Formula | C4H7ClN2OS |
| Molecular Weight | 166.63 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 2H-1,3-thiazole-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1C=CSC1 |
| InChI | InChI=1S/C4H6N2OS.ClH/c5-4(7)6-1-2-8-3-6;/h1-2H,3H2,(H2,5,7);1H |
| InChIKey | GHTSLLKSTXNJCR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-1,3-thiazole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-thiazole-3-carboxamide;hydrochloride?
The IUPAC name of 2H-1,3-thiazole-3-carboxamide;hydrochloride (CID 66980831) is 2H-1,3-thiazole-3-carboxamide;hydrochloride.
What is the SMILES notation for 2H-1,3-thiazole-3-carboxamide;hydrochloride?
The canonical SMILES for 2H-1,3-thiazole-3-carboxamide;hydrochloride is Cl.NC(=O)N1C=CSC1.
What is the InChIKey of 2H-1,3-thiazole-3-carboxamide;hydrochloride?
The InChIKey is GHTSLLKSTXNJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS.ClH/c5-4(7)6-1-2-8-3-6;/h1-2H,3H2,(H2,5,7);1H.
What are the key properties of 2H-1,3-thiazole-3-carboxamide;hydrochloride?
2H-1,3-thiazole-3-carboxamide;hydrochloride has a molecular weight of 166.63 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-thiazole-3-carboxamide;hydrochloride is sourced from PubChem (CID 66980831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).