About 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride
3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride (PubChem CID 66980847) has the molecular formula C7H8ClN3O
and a molecular weight of 185.61 g/mol. Its IUPAC name is 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride |
| PubChem CID | 66980847 |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride |
| SMILES | Cc1n[nH]c(=O)c(C#N)c1C.Cl |
| InChI | InChI=1S/C7H7N3O.ClH/c1-4-5(2)9-10-7(11)6(4)3-8;/h1-2H3,(H,10,11);1H |
| InChIKey | SMVRHKSSSBFOBX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride?
The IUPAC name of 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride (CID 66980847) is 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride.
What is the SMILES notation for 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride?
The canonical SMILES for 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride is Cc1n[nH]c(=O)c(C#N)c1C.Cl.
What is the InChIKey of 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride?
The InChIKey is SMVRHKSSSBFOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.ClH/c1-4-5(2)9-10-7(11)6(4)3-8;/h1-2H3,(H,10,11);1H.
What are the key properties of 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride?
3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride has a molecular weight of 185.61 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonitrile;hydrochloride is sourced from PubChem (CID 66980847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).