C27H47N3O3 — CID 66980870
1,1,2-tris(2-methylcyclohexyl)propane-1,2,3-tricarboxamide (PubChem CID 66980870) has the molecular formula C27H47N3O3 and a molecular weight of 461.69 g/mol. Its IUPAC name is 1,1,2-tris(2-methylcyclohexyl)propane-1,2,3-tricarboxamide.
| Compound Name | 1,1,2-tris(2-methylcyclohexyl)propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 66980870 |
| Molecular Formula | C27H47N3O3 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.36 |
| IUPAC Name | 1,1,2-tris(2-methylcyclohexyl)propane-1,2,3-tricarboxamide |
| SMILES | CC1CCCCC1C(CC(N)=O)(C(N)=O)C(C(N)=O)(C1CCCCC1C)C1CCCCC1C |
| InChI | InChI=1S/C27H47N3O3/c1-17-10-4-7-13-20(17)26(24(29)32,16-23(28)31)27(25(30)33,21-14-8-5-11-18(21)2)22-15-9-6-12-19(22)3/h17-22H,4-16H2,1-3H3,(H2,28,31)(H2,29,32)(H2,30,33) |
| InChIKey | ZBMXWAUSOIAPDW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |