About 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one
5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one (PubChem CID 66981005) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one.
Molecular Properties
| Compound Name | 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one |
| PubChem CID | 66981005 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one |
| SMILES | CC(=O)CC=CC1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C13H20O/c1-11(14)6-4-7-12-8-5-9-13(2,3)10-12/h4,7-8H,5-6,9-10H2,1-3H3 |
| InChIKey | FLVDMGWPJGSMNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one?
The IUPAC name of 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one (CID 66981005) is 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one.
What is the SMILES notation for 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one?
The canonical SMILES for 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one is CC(=O)CC=CC1=CCCC(C)(C)C1.
What is the InChIKey of 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one?
The InChIKey is FLVDMGWPJGSMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-11(14)6-4-7-12-8-5-9-13(2,3)10-12/h4,7-8H,5-6,9-10H2,1-3H3.
What are the key properties of 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one?
5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one has a molecular weight of 192.30 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,5-dimethylcyclohexen-1-yl)pent-4-en-2-one is sourced from PubChem (CID 66981005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).