About 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile
6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile (PubChem CID 66981028) has the molecular formula C18H20ClN5
and a molecular weight of 341.85 g/mol. Its IUPAC name is 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile.
Molecular Properties
| Compound Name | 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile |
| PubChem CID | 66981028 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile |
| SMILES | CCNc1nc2cc(Cl)c(C#CCCCC#N)cc2nc1NCC |
| InChI | InChI=1S/C18H20ClN5/c1-3-21-17-18(22-4-2)24-16-12-14(19)13(11-15(16)23-17)9-7-5-6-8-10-20/h11-12H,3-6,8H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | LQDXRQFKYROSJR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile?
The IUPAC name of 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile (CID 66981028) is 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile.
What is the SMILES notation for 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile?
The canonical SMILES for 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile is CCNc1nc2cc(Cl)c(C#CCCCC#N)cc2nc1NCC.
What is the InChIKey of 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile?
The InChIKey is LQDXRQFKYROSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN5/c1-3-21-17-18(22-4-2)24-16-12-14(19)13(11-15(16)23-17)9-7-5-6-8-10-20/h11-12H,3-6,8H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile?
6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile has a molecular weight of 341.85 g/mol, XLogP of 4.19, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]hex-5-ynenitrile is sourced from PubChem (CID 66981028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).