About 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine
6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine (PubChem CID 66981031) has the molecular formula C18H23ClN4
and a molecular weight of 330.86 g/mol. Its IUPAC name is 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine |
| PubChem CID | 66981031 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine |
| SMILES | CCCCC#Cc1cc2nc(NCC)c(NCC)nc2cc1Cl |
| InChI | InChI=1S/C18H23ClN4/c1-4-7-8-9-10-13-11-15-16(12-14(13)19)23-18(21-6-3)17(22-15)20-5-2/h11-12H,4-8H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | DDGJCGDECRNQPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine?
The IUPAC name of 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine (CID 66981031) is 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine.
What is the SMILES notation for 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine?
The canonical SMILES for 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine is CCCCC#Cc1cc2nc(NCC)c(NCC)nc2cc1Cl.
What is the InChIKey of 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine?
The InChIKey is DDGJCGDECRNQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN4/c1-4-7-8-9-10-13-11-15-16(12-14(13)19)23-18(21-6-3)17(22-15)20-5-2/h11-12H,4-8H2,1-3H3,(H,20,22)(H,21,23).
What are the key properties of 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine?
6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine has a molecular weight of 330.86 g/mol, XLogP of 4.69, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N,3-N-diethyl-7-hex-1-ynylquinoxaline-2,3-diamine is sourced from PubChem (CID 66981031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).