About (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate
(5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate (PubChem CID 66981271) has the molecular formula C10H11BrFN3O2
and a molecular weight of 304.12 g/mol. Its IUPAC name is (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate.
Molecular Properties
| Compound Name | (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate |
| PubChem CID | 66981271 |
| Molecular Formula | C10H11BrFN3O2 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate |
| SMILES | O=C(Oc1ncc(Br)cn1)C1(F)CCNCC1 |
| InChI | InChI=1S/C10H11BrFN3O2/c11-7-5-14-9(15-6-7)17-8(16)10(12)1-3-13-4-2-10/h5-6,13H,1-4H2 |
| InChIKey | CHBNORGAURGFGR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate?
The IUPAC name of (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate (CID 66981271) is (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate.
What is the SMILES notation for (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate?
The canonical SMILES for (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate is O=C(Oc1ncc(Br)cn1)C1(F)CCNCC1.
What is the InChIKey of (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate?
The InChIKey is CHBNORGAURGFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrFN3O2/c11-7-5-14-9(15-6-7)17-8(16)10(12)1-3-13-4-2-10/h5-6,13H,1-4H2.
What are the key properties of (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate?
(5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate has a molecular weight of 304.12 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromopyrimidin-2-yl) 4-fluoropiperidine-4-carboxylate is sourced from PubChem (CID 66981271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).