C24H24ClN5O2 — CID 66981702
(3aR,8bS)-7-[[5-chloro-4-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-4H-pyrimidin-2-yl]amino]-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazol-2-one (PubChem CID 66981702) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is (3aR,8bS)-7-[[5-chloro-4-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-4H-pyrimidin-2-yl]amino]-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazol-2-one.
| Compound Name | (3aR,8bS)-7-[[5-chloro-4-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-4H-pyrimidin-2-yl]amino]-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 66981702 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3aR,8bS)-7-[[5-chloro-4-(2,3-dihydro-1H-inden-4-ylamino)-5-methyl-4H-pyrimidin-2-yl]amino]-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazol-2-one |
| SMILES | CC1(Cl)C=NC(Nc2ccc3c(c2)[C@@H]2NC(=O)O[C@@H]2C3)=NC1Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C24H24ClN5O2/c1-24(25)12-26-22(30-21(24)28-18-7-3-5-13-4-2-6-16(13)18)27-15-9-8-14-10-19-20(17(14)11-15)29-23(31)32-19/h3,5,7-9,11-12,19-21,28H,2,4,6,10H2,1H3,(H,27,30)(H,29,31)/t19-,20+,21?,24?/m1/s1 |
| InChIKey | DFSHLWOLFJGTEN-YAQHWNNOSA-N |
| XLogP | 4.17 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|