C14H17F2NO — CID 66982673
(E)-2-[[4-(cyclopropylmethoxy)-3-fluorophenyl]methyl]-3-fluoroprop-2-en-1-amine (PubChem CID 66982673) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is (E)-2-[[4-(cyclopropylmethoxy)-3-fluorophenyl]methyl]-3-fluoroprop-2-en-1-amine.
| Compound Name | (E)-2-[[4-(cyclopropylmethoxy)-3-fluorophenyl]methyl]-3-fluoroprop-2-en-1-amine |
|---|---|
| PubChem CID | 66982673 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (E)-2-[[4-(cyclopropylmethoxy)-3-fluorophenyl]methyl]-3-fluoroprop-2-en-1-amine |
| SMILES | NC/C(=C/F)Cc1ccc(OCC2CC2)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO/c15-7-12(8-17)5-11-3-4-14(13(16)6-11)18-9-10-1-2-10/h3-4,6-7,10H,1-2,5,8-9,17H2/b12-7+ |
| InChIKey | TZWWYQBVWSPPDF-KPKJPENVSA-N |
| XLogP | 2.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |