C23H25ClN2O5 — CID 66982833
but-2-enedioic acid;4-[(3-chlorophenyl)methyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 66982833) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is but-2-enedioic acid;4-[(3-chlorophenyl)methyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | but-2-enedioic acid;4-[(3-chlorophenyl)methyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 66982833 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | but-2-enedioic acid;4-[(3-chlorophenyl)methyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | Clc1cccc(CN2CCOc3cc4c(cc32)CCNCC4)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H21ClN2O.C4H4O4/c20-17-3-1-2-14(10-17)13-22-8-9-23-19-12-16-5-7-21-6-4-15(16)11-18(19)22;5-3(6)1-2-4(7)8/h1-3,10-12,21H,4-9,13H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DIRLFFSYDJMNFU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|