C23H31ClN4O4 — CID 66983171
4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-N-[(2R)-2,3-dihydroxypropyl]-2-methylbenzamide (PubChem CID 66983171) has the molecular formula C23H31ClN4O4 and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-N-[(2R)-2,3-dihydroxypropyl]-2-methylbenzamide.
| Compound Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-N-[(2R)-2,3-dihydroxypropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 66983171 |
| Molecular Formula | C23H31ClN4O4 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-N-[(2R)-2,3-dihydroxypropyl]-2-methylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)ccc1C(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C23H31ClN4O4/c1-16-11-20(4-5-21(16)22(31)25-14-19(30)15-29)32-10-2-3-17-6-8-28(9-7-17)23-26-12-18(24)13-27-23/h4-5,11-13,17,19,29-30H,2-3,6-10,14-15H2,1H3,(H,25,31)/t19-/m1/s1 |
| InChIKey | MIRYHYZKLOTGFM-LJQANCHMSA-N |
| XLogP | 2.60 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|