C21H38O4 — CID 66983610
3-O-heptyl 1-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate (PubChem CID 66983610) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 3-O-heptyl 1-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate.
| Compound Name | 3-O-heptyl 1-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66983610 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 3-O-heptyl 1-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate |
| SMILES | CCCCCCCOC(=O)C1CCCC(C(=O)OCCCC(C)C)C1 |
| InChI | InChI=1S/C21H38O4/c1-4-5-6-7-8-14-24-20(22)18-12-9-13-19(16-18)21(23)25-15-10-11-17(2)3/h17-19H,4-16H2,1-3H3 |
| InChIKey | AUUJERACYSILAF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|