About 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate
1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate (PubChem CID 66984358) has the molecular formula C29H27N5O3
and a molecular weight of 493.57 g/mol. Its IUPAC name is 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate |
| PubChem CID | 66984358 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate |
| SMILES | CC(OC(=O)Nc1ccc(-c2c(C#N)c3ccc(Oc4ncccn4)cc3n2C2CCC2)cc1)C1CC1 |
| InChI | InChI=1S/C29H27N5O3/c1-18(19-6-7-19)36-29(35)33-21-10-8-20(9-11-21)27-25(17-30)24-13-12-23(37-28-31-14-3-15-32-28)16-26(24)34(27)22-4-2-5-22/h3,8-16,18-19,22H,2,4-7H2,1H3,(H,33,35) |
| InChIKey | LZNIOXSDLNFILJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate?
The IUPAC name of 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate (CID 66984358) is 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate.
What is the SMILES notation for 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate?
The canonical SMILES for 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate is CC(OC(=O)Nc1ccc(-c2c(C#N)c3ccc(Oc4ncccn4)cc3n2C2CCC2)cc1)C1CC1.
What is the InChIKey of 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate?
The InChIKey is LZNIOXSDLNFILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N5O3/c1-18(19-6-7-19)36-29(35)33-21-10-8-20(9-11-21)27-25(17-30)24-13-12-23(37-28-31-14-3-15-32-28)16-26(24)34(27)22-4-2-5-22/h3,8-16,18-19,22H,2,4-7H2,1H3,(H,33,35).
What are the key properties of 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate?
1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate has a molecular weight of 493.57 g/mol, XLogP of 6.83, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethyl N-[4-(3-cyano-1-cyclobutyl-6-pyrimidin-2-yloxyindol-2-yl)phenyl]carbamate is sourced from PubChem (CID 66984358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).