C22H42O6 — CID 66984416
3-dodecoxycarbonylcyclohexane-1-carboxylic acid;ethane-1,2-diol (PubChem CID 66984416) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is 3-dodecoxycarbonylcyclohexane-1-carboxylic acid;ethane-1,2-diol.
| Compound Name | 3-dodecoxycarbonylcyclohexane-1-carboxylic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 66984416 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 3-dodecoxycarbonylcyclohexane-1-carboxylic acid;ethane-1,2-diol |
| SMILES | CCCCCCCCCCCCOC(=O)C1CCCC(C(=O)O)C1.OCCO |
| InChI | InChI=1S/C20H36O4.C2H6O2/c1-2-3-4-5-6-7-8-9-10-11-15-24-20(23)18-14-12-13-17(16-18)19(21)22;3-1-2-4/h17-18H,2-16H2,1H3,(H,21,22);3-4H,1-2H2 |
| InChIKey | HNZHCCAMFYCOAF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|