C20H36O4 — CID 66984433
3-O-(6-methylheptyl) 1-O-(2-methylpropyl) cyclohexane-1,3-dicarboxylate (PubChem CID 66984433) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 3-O-(6-methylheptyl) 1-O-(2-methylpropyl) cyclohexane-1,3-dicarboxylate.
| Compound Name | 3-O-(6-methylheptyl) 1-O-(2-methylpropyl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66984433 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 3-O-(6-methylheptyl) 1-O-(2-methylpropyl) cyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)CCCCCOC(=O)C1CCCC(C(=O)OCC(C)C)C1 |
| InChI | InChI=1S/C20H36O4/c1-15(2)9-6-5-7-12-23-19(21)17-10-8-11-18(13-17)20(22)24-14-16(3)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | SWYBDIAYECNAEP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|