C21H36O6 — CID 66984774
1-O,2-O-diethyl 4-O-hexyl 1-ethylcyclohexane-1,2,4-tricarboxylate (PubChem CID 66984774) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-O,2-O-diethyl 4-O-hexyl 1-ethylcyclohexane-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-diethyl 4-O-hexyl 1-ethylcyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 66984774 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-O,2-O-diethyl 4-O-hexyl 1-ethylcyclohexane-1,2,4-tricarboxylate |
| SMILES | CCCCCCOC(=O)C1CCC(CC)(C(=O)OCC)C(C(=O)OCC)C1 |
| InChI | InChI=1S/C21H36O6/c1-5-9-10-11-14-27-18(22)16-12-13-21(6-2,20(24)26-8-4)17(15-16)19(23)25-7-3/h16-17H,5-15H2,1-4H3 |
| InChIKey | FGWAHEXQOWIXAN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|