C12H13F3N6O — CID 66984794
2-(pyrrolidin-3-ylamino)-4-(trifluoromethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 66984794) has the molecular formula C12H13F3N6O and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylamino)-4-(trifluoromethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-(pyrrolidin-3-ylamino)-4-(trifluoromethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 66984794 |
| Molecular Formula | C12H13F3N6O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(pyrrolidin-3-ylamino)-4-(trifluoromethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1[nH]ccc2nc(NC3CCNC3)nc(NC(F)(F)F)c12 |
| InChI | InChI=1S/C12H13F3N6O/c13-12(14,15)21-9-8-7(2-4-17-10(8)22)19-11(20-9)18-6-1-3-16-5-6/h2,4,6,16H,1,3,5H2,(H,17,22)(H2,18,19,20,21) |
| InChIKey | LXXFNKXAYDRVIP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|