C24H25F3N8O — CID 66984922
2-(2,2-difluoropiperidin-1-yl)-N-[(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]acetamide (PubChem CID 66984922) has the molecular formula C24H25F3N8O and a molecular weight of 498.51 g/mol. Its IUPAC name is 2-(2,2-difluoropiperidin-1-yl)-N-[(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]acetamide.
| Compound Name | 2-(2,2-difluoropiperidin-1-yl)-N-[(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 66984922 |
| Molecular Formula | C24H25F3N8O |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 2-(2,2-difluoropiperidin-1-yl)-N-[(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]acetamide |
| SMILES | Cc1cc(Nc2nc(C(NC(=O)CN3CCCCC3(F)F)c3ccc(F)cc3)nn3cccc23)n[nH]1 |
| InChI | InChI=1S/C24H25F3N8O/c1-15-13-19(32-31-15)28-22-18-5-4-12-35(18)33-23(30-22)21(16-6-8-17(25)9-7-16)29-20(36)14-34-11-3-2-10-24(34,26)27/h4-9,12-13,21H,2-3,10-11,14H2,1H3,(H,29,36)(H2,28,30,31,32,33) |
| InChIKey | BPSQOXJLARDFEQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|