About methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate
methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate (PubChem CID 66984966) has the molecular formula C15H12F3N3O4
and a molecular weight of 355.27 g/mol. Its IUPAC name is methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate |
| PubChem CID | 66984966 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(C(N)=O)n(NC(=O)C(F)(F)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H12F3N3O4/c1-25-13(23)8-6-11(12(19)22)21(7-8)20-14(24)15(17,18)9-2-4-10(16)5-3-9/h2-7H,1H3,(H2,19,22)(H,20,24) |
| InChIKey | JEINTEIEVICVMK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate?
The IUPAC name of methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate (CID 66984966) is methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate.
What is the SMILES notation for methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate?
The canonical SMILES for methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate is COC(=O)c1cc(C(N)=O)n(NC(=O)C(F)(F)c2ccc(F)cc2)c1.
What is the InChIKey of methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate?
The InChIKey is JEINTEIEVICVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3N3O4/c1-25-13(23)8-6-11(12(19)22)21(7-8)20-14(24)15(17,18)9-2-4-10(16)5-3-9/h2-7H,1H3,(H2,19,22)(H,20,24).
What are the key properties of methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate?
methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate has a molecular weight of 355.27 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-carbamoyl-1-[[2,2-difluoro-2-(4-fluorophenyl)acetyl]amino]pyrrole-3-carboxylate is sourced from PubChem (CID 66984966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).