About 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid
1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid (PubChem CID 66984973) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid |
| PubChem CID | 66984973 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid |
| SMILES | O=C(O)c1ncncn1.Oc1cc[nH]c1 |
| InChI | InChI=1S/C4H3N3O2.C4H5NO/c8-4(9)3-6-1-5-2-7-3;6-4-1-2-5-3-4/h1-2H,(H,8,9);1-3,5-6H |
| InChIKey | JDVVZHGCNSTLTB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid?
The IUPAC name of 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid (CID 66984973) is 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid.
What is the SMILES notation for 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid?
The canonical SMILES for 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid is O=C(O)c1ncncn1.Oc1cc[nH]c1.
What is the InChIKey of 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid?
The InChIKey is JDVVZHGCNSTLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3O2.C4H5NO/c8-4(9)3-6-1-5-2-7-3;6-4-1-2-5-3-4/h1-2H,(H,8,9);1-3,5-6H.
What are the key properties of 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid?
1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid has a molecular weight of 208.18 g/mol, XLogP of 0.29, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrol-3-ol;1,3,5-triazine-2-carboxylic acid is sourced from PubChem (CID 66984973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).