C25H35N3O2 — CID 66985326
(4-methoxycyclohexyl)-[(1S,12R)-1,5,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]methanone (PubChem CID 66985326) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is (4-methoxycyclohexyl)-[(1S,12R)-1,5,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]methanone.
| Compound Name | (4-methoxycyclohexyl)-[(1S,12R)-1,5,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]methanone |
|---|---|
| PubChem CID | 66985326 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | (4-methoxycyclohexyl)-[(1S,12R)-1,5,16,16-tetramethyl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),6,9-tetraen-13-yl]methanone |
| SMILES | COC1CCC(C(=O)N2CC[C@@]3(C)c4cc5c(cc4C[C@@H]2C3(C)C)ncn5C)CC1 |
| InChI | InChI=1S/C25H35N3O2/c1-24(2)22-13-17-12-20-21(27(4)15-26-20)14-19(17)25(24,3)10-11-28(22)23(29)16-6-8-18(30-5)9-7-16/h12,14-16,18,22H,6-11,13H2,1-5H3/t16?,18?,22-,25+/m1/s1 |
| InChIKey | DLKZFQWNJIOJTB-WWAJGDBYSA-N |
| XLogP | 4.22 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |