About bicyclo[2.2.0]hexane;ethanol
bicyclo[2.2.0]hexane;ethanol (PubChem CID 66985462) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;ethanol.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexane;ethanol |
| PubChem CID | 66985462 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | bicyclo[2.2.0]hexane;ethanol |
| SMILES | C1CC2CCC12.CCO |
| InChI | InChI=1S/C6H10.C2H6O/c1-2-6-4-3-5(1)6;1-2-3/h5-6H,1-4H2;3H,2H2,1H3 |
| InChIKey | FLQRRMHGDKIZGA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.2.0]hexane;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexane;ethanol?
The IUPAC name of bicyclo[2.2.0]hexane;ethanol (CID 66985462) is bicyclo[2.2.0]hexane;ethanol.
What is the SMILES notation for bicyclo[2.2.0]hexane;ethanol?
The canonical SMILES for bicyclo[2.2.0]hexane;ethanol is C1CC2CCC12.CCO.
What is the InChIKey of bicyclo[2.2.0]hexane;ethanol?
The InChIKey is FLQRRMHGDKIZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.C2H6O/c1-2-6-4-3-5(1)6;1-2-3/h5-6H,1-4H2;3H,2H2,1H3.
What are the key properties of bicyclo[2.2.0]hexane;ethanol?
bicyclo[2.2.0]hexane;ethanol has a molecular weight of 128.22 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexane;ethanol is sourced from PubChem (CID 66985462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).