About bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate
bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate (PubChem CID 66985688) has the molecular formula C19H30O9
and a molecular weight of 402.44 g/mol. Its IUPAC name is bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate.
Molecular Properties
| Compound Name | bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate |
| PubChem CID | 66985688 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate |
| SMILES | CC(C)C(OC(=O)OC(C(C)C)C1(C)COC(=O)OC1)C1(C)COC(=O)OC1 |
| InChI | InChI=1S/C19H30O9/c1-11(2)13(18(5)7-23-15(20)24-8-18)27-17(22)28-14(12(3)4)19(6)9-25-16(21)26-10-19/h11-14H,7-10H2,1-6H3 |
| InChIKey | SYOYOFKHUVXCNZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate?
The IUPAC name of bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate (CID 66985688) is bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate.
What is the SMILES notation for bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate?
The canonical SMILES for bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate is CC(C)C(OC(=O)OC(C(C)C)C1(C)COC(=O)OC1)C1(C)COC(=O)OC1.
What is the InChIKey of bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate?
The InChIKey is SYOYOFKHUVXCNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O9/c1-11(2)13(18(5)7-23-15(20)24-8-18)27-17(22)28-14(12(3)4)19(6)9-25-16(21)26-10-19/h11-14H,7-10H2,1-6H3.
What are the key properties of bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate?
bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate has a molecular weight of 402.44 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-methyl-1-(5-methyl-2-oxo-1,3-dioxan-5-yl)propyl] carbonate is sourced from PubChem (CID 66985688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).