C18H24N2O5 — CID 66985849
tert-butyl N-[[3-[[[(2R)-5-oxooxolane-2-carbonyl]amino]methyl]phenyl]methyl]carbamate (PubChem CID 66985849) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl N-[[3-[[[(2R)-5-oxooxolane-2-carbonyl]amino]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[[(2R)-5-oxooxolane-2-carbonyl]amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 66985849 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl N-[[3-[[[(2R)-5-oxooxolane-2-carbonyl]amino]methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CNC(=O)[C@H]2CCC(=O)O2)c1 |
| InChI | InChI=1S/C18H24N2O5/c1-18(2,3)25-17(23)20-11-13-6-4-5-12(9-13)10-19-16(22)14-7-8-15(21)24-14/h4-6,9,14H,7-8,10-11H2,1-3H3,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | LGZQXMNOVNUXCK-CQSZACIVSA-N |
| XLogP | 2.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |