C16H13Cl2N3O4 — CID 66985901
2-[2-(2,5-dichlorophenyl)-4-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]propanoic acid (PubChem CID 66985901) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)-4-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]propanoic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)-4-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 66985901 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)-4-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]propanoic acid |
| SMILES | Cc1c2c(=O)n(-c3cc(Cl)ccc3Cl)[nH]c2cc(=O)n1C(C)C(=O)O |
| InChI | InChI=1S/C16H13Cl2N3O4/c1-7-14-11(6-13(22)20(7)8(2)16(24)25)19-21(15(14)23)12-5-9(17)3-4-10(12)18/h3-6,8,19H,1-2H3,(H,24,25) |
| InChIKey | ZEXUNOLTCMJVLS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|