C44H47Cl3N4O2SSi — CID 66987416
[3-[1-[(4-chlorophenyl)methyl]-5-[6,6-dichloro-1-(4-methylphenyl)sulfonyl-2H-indol-3-yl]-4-phenylimidazol-2-yl]pyrrol-1-yl]-tri(propan-2-yl)silane (PubChem CID 66987416) has the molecular formula C44H47Cl3N4O2SSi and a molecular weight of 830.40 g/mol. Its IUPAC name is [3-[1-[(4-chlorophenyl)methyl]-5-[6,6-dichloro-1-(4-methylphenyl)sulfonyl-2H-indol-3-yl]-4-phenylimidazol-2-yl]pyrrol-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [3-[1-[(4-chlorophenyl)methyl]-5-[6,6-dichloro-1-(4-methylphenyl)sulfonyl-2H-indol-3-yl]-4-phenylimidazol-2-yl]pyrrol-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 66987416 |
| Molecular Formula | C44H47Cl3N4O2SSi |
| Molecular Weight | 830.40 g/mol |
| Exact Mass | 828.23 |
| IUPAC Name | [3-[1-[(4-chlorophenyl)methyl]-5-[6,6-dichloro-1-(4-methylphenyl)sulfonyl-2H-indol-3-yl]-4-phenylimidazol-2-yl]pyrrol-1-yl]-tri(propan-2-yl)silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3c(-c4ccccc4)nc(-c4ccn([Si](C(C)C)(C(C)C)C(C)C)c4)n3Cc3ccc(Cl)cc3)=C3C=CC(Cl)(Cl)C=C32)cc1 |
| InChI | InChI=1S/C44H47Cl3N4O2SSi/c1-29(2)55(30(3)4,31(5)6)49-24-22-35(27-49)43-48-41(34-11-9-8-10-12-34)42(50(43)26-33-15-17-36(45)18-16-33)39-28-51(40-25-44(46,47)23-21-38(39)40)54(52,53)37-19-13-32(7)14-20-37/h8-25,27,29-31H,26,28H2,1-7H3 |
| InChIKey | QQOJZHWSSLMDSZ-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.40 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|