C25H16Cl2N4 — CID 66987515
6-chloro-3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-2-carbonitrile (PubChem CID 66987515) has the molecular formula C25H16Cl2N4 and a molecular weight of 443.34 g/mol. Its IUPAC name is 6-chloro-3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-2-carbonitrile.
| Compound Name | 6-chloro-3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-2-carbonitrile |
|---|---|
| PubChem CID | 66987515 |
| Molecular Formula | C25H16Cl2N4 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 6-chloro-3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-2-carbonitrile |
| SMILES | N#Cc1[nH]c2cc(Cl)ccc2c1-c1c(-c2ccccc2)ncn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16Cl2N4/c26-18-8-6-16(7-9-18)14-31-15-29-24(17-4-2-1-3-5-17)25(31)23-20-11-10-19(27)12-21(20)30-22(23)13-28/h1-12,15,30H,14H2 |
| InChIKey | KHCMWPIJYBOJSM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |