C28H33N3O — CID 66987550
(1R,9R,13E)-1-[3-[4-(diethylamino)phenyl]prop-2-enylideneamino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 66987550) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is (1R,9R,13E)-1-[3-[4-(diethylamino)phenyl]prop-2-enylideneamino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R,9R,13E)-1-[3-[4-(diethylamino)phenyl]prop-2-enylideneamino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 66987550 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (1R,9R,13E)-1-[3-[4-(diethylamino)phenyl]prop-2-enylideneamino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(/N=C/C=Cc1ccc(N(CC)CC)cc1)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C28H33N3O/c1-5-24-22-17-20(4)19-28(24,25-14-15-27(32)30-26(25)18-22)29-16-8-9-21-10-12-23(13-11-21)31(6-2)7-3/h5,8-17,22H,6-7,18-19H2,1-4H3,(H,30,32)/b9-8?,24-5+,29-16+/t22-,28+/m0/s1 |
| InChIKey | NQTBELFPKKWHMG-PFLVTSAQSA-N |
| XLogP | 5.67 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|