C25H26N2O — CID 66987734
(1R,9R,13E)-13-ethylidene-11-methyl-1-[[(E)-3-(2-methylphenyl)prop-2-enylidene]amino]-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 66987734) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is (1R,9R,13E)-13-ethylidene-11-methyl-1-[[(E)-3-(2-methylphenyl)prop-2-enylidene]amino]-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R,9R,13E)-13-ethylidene-11-methyl-1-[[(E)-3-(2-methylphenyl)prop-2-enylidene]amino]-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 66987734 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1R,9R,13E)-13-ethylidene-11-methyl-1-[[(E)-3-(2-methylphenyl)prop-2-enylidene]amino]-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(/N=C/C=C/c1ccccc1C)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C25H26N2O/c1-4-21-20-14-17(2)16-25(21,22-11-12-24(28)27-23(22)15-20)26-13-7-10-19-9-6-5-8-18(19)3/h4-14,20H,15-16H2,1-3H3,(H,27,28)/b10-7+,21-4+,26-13+/t20-,25+/m0/s1 |
| InChIKey | GHDBXELVLKNUIR-SFBKLEAUSA-N |
| XLogP | 5.13 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|