About 5-phenyl-1H-pyrrol-2-ol
5-phenyl-1H-pyrrol-2-ol (PubChem CID 66988557) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-phenyl-1H-pyrrol-2-ol.
Molecular Properties
| Compound Name | 5-phenyl-1H-pyrrol-2-ol |
| PubChem CID | 66988557 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-phenyl-1H-pyrrol-2-ol |
| SMILES | Oc1ccc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C10H9NO/c12-10-7-6-9(11-10)8-4-2-1-3-5-8/h1-7,11-12H |
| InChIKey | GLIRPUCVNRQHSM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenyl-1H-pyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1H-pyrrol-2-ol?
The IUPAC name of 5-phenyl-1H-pyrrol-2-ol (CID 66988557) is 5-phenyl-1H-pyrrol-2-ol.
What is the SMILES notation for 5-phenyl-1H-pyrrol-2-ol?
The canonical SMILES for 5-phenyl-1H-pyrrol-2-ol is Oc1ccc(-c2ccccc2)[nH]1.
What is the InChIKey of 5-phenyl-1H-pyrrol-2-ol?
The InChIKey is GLIRPUCVNRQHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-10-7-6-9(11-10)8-4-2-1-3-5-8/h1-7,11-12H.
What are the key properties of 5-phenyl-1H-pyrrol-2-ol?
5-phenyl-1H-pyrrol-2-ol has a molecular weight of 159.19 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1H-pyrrol-2-ol is sourced from PubChem (CID 66988557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).