About [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid
[2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid (PubChem CID 66989542) has the molecular formula C26H36N2O2
and a molecular weight of 408.59 g/mol. Its IUPAC name is [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid.
Molecular Properties
| Compound Name | [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid |
| PubChem CID | 66989542 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid |
| SMILES | CC(C)(C)C(NC(=O)O)C1CCN(C(C)(C)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H36N2O2/c1-25(2,3)23(27-24(29)30)21-15-17-28(18-16-21)26(4,5)22-13-11-20(12-14-22)19-9-7-6-8-10-19/h6-14,21,23,27H,15-18H2,1-5H3,(H,29,30) |
| InChIKey | QQHBIXZNGWFKEB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid?
The IUPAC name of [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid (CID 66989542) is [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid.
What is the SMILES notation for [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid?
The canonical SMILES for [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid is CC(C)(C)C(NC(=O)O)C1CCN(C(C)(C)c2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid?
The InChIKey is QQHBIXZNGWFKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N2O2/c1-25(2,3)23(27-24(29)30)21-15-17-28(18-16-21)26(4,5)22-13-11-20(12-14-22)19-9-7-6-8-10-19/h6-14,21,23,27H,15-18H2,1-5H3,(H,29,30).
What are the key properties of [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid?
[2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid has a molecular weight of 408.59 g/mol, XLogP of 5.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-1-[1-[2-(4-phenylphenyl)propan-2-yl]piperidin-4-yl]propyl]carbamic acid is sourced from PubChem (CID 66989542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).