C29H31FN2O4 — CID 66989600
[6-amino-3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-2-methoxyphenyl] acetate (PubChem CID 66989600) has the molecular formula C29H31FN2O4 and a molecular weight of 490.58 g/mol. Its IUPAC name is [6-amino-3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-2-methoxyphenyl] acetate.
| Compound Name | [6-amino-3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 66989600 |
| Molecular Formula | C29H31FN2O4 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [6-amino-3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1c(-c2ccc3c(c2COc2cc(F)ccc2C)C(C)=CC(C)(C)N3)ccc(N)c1OC(C)=O |
| InChI | InChI=1S/C29H31FN2O4/c1-16-7-8-19(30)13-25(16)35-15-22-20(10-12-24-26(22)17(2)14-29(4,5)32-24)21-9-11-23(31)28(27(21)34-6)36-18(3)33/h7-14,32H,15,31H2,1-6H3 |
| InChIKey | KQEZTBGVCWTHOF-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|