About CID 66989915
CID 66989915 (PubChem CID 66989915) has the molecular formula C21H19OSi
and a molecular weight of 315.47 g/mol.
Molecular Properties
| Compound Name | CID 66989915 |
| PubChem CID | 66989915 |
| Molecular Formula | C21H19OSi |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1-c1cccc(CO[Si])c1-c1ccccc1C |
| InChI | InChI=1S/C21H19OSi/c1-15-8-3-5-11-18(15)20-13-7-10-17(14-22-23)21(20)19-12-6-4-9-16(19)2/h3-13H,14H2,1-2H3 |
| InChIKey | HYSBCTBPHDHLED-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66989915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66989915?
The IUPAC name of CID 66989915 (CID 66989915) is not available.
What is the SMILES notation for CID 66989915?
The canonical SMILES for CID 66989915 is Cc1ccccc1-c1cccc(CO[Si])c1-c1ccccc1C.
What is the InChIKey of CID 66989915?
The InChIKey is HYSBCTBPHDHLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19OSi/c1-15-8-3-5-11-18(15)20-13-7-10-17(14-22-23)21(20)19-12-6-4-9-16(19)2/h3-13H,14H2,1-2H3.
What are the key properties of CID 66989915?
CID 66989915 has a molecular weight of 315.47 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66989915 is sourced from PubChem (CID 66989915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).