C26H16O4 — CID 6699
1,5-diphenoxyanthracene-9,10-dione (PubChem CID 6699) has the molecular formula C26H16O4 and a molecular weight of 392.41 g/mol. Its IUPAC name is 1,5-diphenoxyanthracene-9,10-dione.
| Compound Name | 1,5-diphenoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 6699 |
| Molecular Formula | C26H16O4 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1,5-diphenoxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(Oc3ccccc3)c2C(=O)c2cccc(Oc3ccccc3)c21 |
| InChI | InChI=1S/C26H16O4/c27-25-20-14-8-16-22(30-18-11-5-2-6-12-18)24(20)26(28)19-13-7-15-21(23(19)25)29-17-9-3-1-4-10-17/h1-16H |
| InChIKey | GSNYYYXHQZHEFP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|