C27H34N6O4Si — CID 66990281
ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 66990281) has the molecular formula C27H34N6O4Si and a molecular weight of 534.69 g/mol. Its IUPAC name is ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66990281 |
| Molecular Formula | C27H34N6O4Si |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-c3nc(C(=O)NCc4ccncc4)n(COCC[Si](C)(C)C)c3C)cnc2[nH]1 |
| InChI | InChI=1S/C27H34N6O4Si/c1-6-37-27(35)22-14-20-13-21(16-29-24(20)31-22)23-18(2)33(17-36-11-12-38(3,4)5)25(32-23)26(34)30-15-19-7-9-28-10-8-19/h7-10,13-14,16H,6,11-12,15,17H2,1-5H3,(H,29,31)(H,30,34) |
| InChIKey | HSXLXHWBXOXGIU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|