C41H43N3O8 — CID 6699051
benzyl N-[1-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6699051) has the molecular formula C41H43N3O8 and a molecular weight of 705.81 g/mol. Its IUPAC name is benzyl N-[1-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6699051 |
| Molecular Formula | C41H43N3O8 |
| Molecular Weight | 705.81 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | benzyl N-[1-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(Cc2cccc(-c3cccc([C@H]4O[C@@H](CN5CC[C@H](O)C5)C[C@@H](c5ccc(CO)cc5)O4)c3)c2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H43N3O8/c45-25-27-12-14-30(15-13-27)37-20-35(24-43-17-16-34(46)23-43)51-40(52-37)33-11-5-10-32(19-33)31-9-4-8-29(18-31)22-44-38(47)21-36(39(44)48)42-41(49)50-26-28-6-2-1-3-7-28/h1-15,18-19,34-37,40,45-46H,16-17,20-26H2,(H,42,49)/t34-,35+,36?,37-,40-/m0/s1 |
| InChIKey | FZPJYIIMZDJDND-DEEABCIWSA-N |
| XLogP | 5.01 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|