About [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride
[1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride (PubChem CID 66990824) has the molecular formula C16H25Cl3N4S
and a molecular weight of 411.83 g/mol. Its IUPAC name is [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride.
Molecular Properties
| Compound Name | [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride |
| PubChem CID | 66990824 |
| Molecular Formula | C16H25Cl3N4S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride |
| SMILES | CC(c1cnc(-c2ccccn2)s1)N1CCC(CN)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C16H22N4S.3ClH/c1-12(20-8-5-13(10-17)6-9-20)15-11-19-16(21-15)14-4-2-3-7-18-14;;;/h2-4,7,11-13H,5-6,8-10,17H2,1H3;3*1H |
| InChIKey | IEJSUZDSOVWCEV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride?
The IUPAC name of [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride (CID 66990824) is [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride.
What is the SMILES notation for [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride?
The canonical SMILES for [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride is CC(c1cnc(-c2ccccn2)s1)N1CCC(CN)CC1.Cl.Cl.Cl.
What is the InChIKey of [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride?
The InChIKey is IEJSUZDSOVWCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4S.3ClH/c1-12(20-8-5-13(10-17)6-9-20)15-11-19-16(21-15)14-4-2-3-7-18-14;;;/h2-4,7,11-13H,5-6,8-10,17H2,1H3;3*1H.
What are the key properties of [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride?
[1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride has a molecular weight of 411.83 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2-pyridin-2-yl-1,3-thiazol-5-yl)ethyl]piperidin-4-yl]methanamine;trihydrochloride is sourced from PubChem (CID 66990824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).