C26H26N2O3 — CID 66993025
methyl 2-[(E)-3-[[(1R,9R,13E)-13-ethylidene-11-methyl-5-oxo-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]imino]prop-1-enyl]benzoate (PubChem CID 66993025) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is methyl 2-[(E)-3-[[(1R,9R,13E)-13-ethylidene-11-methyl-5-oxo-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]imino]prop-1-enyl]benzoate.
| Compound Name | methyl 2-[(E)-3-[[(1R,9R,13E)-13-ethylidene-11-methyl-5-oxo-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]imino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 66993025 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | methyl 2-[(E)-3-[[(1R,9R,13E)-13-ethylidene-11-methyl-5-oxo-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]imino]prop-1-enyl]benzoate |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(/N=C/C=C/c1ccccc1C(=O)OC)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C26H26N2O3/c1-4-21-19-14-17(2)16-26(21,22-11-12-24(29)28-23(22)15-19)27-13-7-9-18-8-5-6-10-20(18)25(30)31-3/h4-14,19H,15-16H2,1-3H3,(H,28,29)/b9-7+,21-4+,27-13+/t19-,26+/m0/s1 |
| InChIKey | JLKUYDZHQKMDMI-SQLQLFBHSA-N |
| XLogP | 4.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|