About 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine
4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine (PubChem CID 66993376) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine |
| PubChem CID | 66993376 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine |
| SMILES | C=CC(N)C(C=C)C1=NCCN1 |
| InChI | InChI=1S/C9H15N3/c1-3-7(8(10)4-2)9-11-5-6-12-9/h3-4,7-8H,1-2,5-6,10H2,(H,11,12) |
| InChIKey | FIKUOBIYWKTGAO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine (CID 66993376) is 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine is C=CC(N)C(C=C)C1=NCCN1.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine?
The InChIKey is FIKUOBIYWKTGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-3-7(8(10)4-2)9-11-5-6-12-9/h3-4,7-8H,1-2,5-6,10H2,(H,11,12).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine?
4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine has a molecular weight of 165.24 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-yl)hexa-1,5-dien-3-amine is sourced from PubChem (CID 66993376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).