About CID 66993449
CID 66993449 (PubChem CID 66993449) has the molecular formula C25H17BNOS2
and a molecular weight of 422.36 g/mol.
Molecular Properties
| Compound Name | CID 66993449 |
| PubChem CID | 66993449 |
| Molecular Formula | C25H17BNOS2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | — |
| SMILES | Oc1cccc2cccnc12.[B](c1cc2ccccc2s1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H10BS2.C9H7NO/c1-3-7-13-11(5-1)9-15(18-13)17-16-10-12-6-2-4-8-14(12)19-16;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-10H;1-6,11H |
| InChIKey | LZVLHYRAPHMOTC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66993449 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66993449?
The IUPAC name of CID 66993449 (CID 66993449) is not available.
What is the SMILES notation for CID 66993449?
The canonical SMILES for CID 66993449 is Oc1cccc2cccnc12.[B](c1cc2ccccc2s1)c1cc2ccccc2s1.
What is the InChIKey of CID 66993449?
The InChIKey is LZVLHYRAPHMOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BS2.C9H7NO/c1-3-7-13-11(5-1)9-15(18-13)17-16-10-12-6-2-4-8-14(12)19-16;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-10H;1-6,11H.
What are the key properties of CID 66993449?
CID 66993449 has a molecular weight of 422.36 g/mol, XLogP of 5.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66993449 is sourced from PubChem (CID 66993449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).