About N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine
N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine (PubChem CID 66993843) has the molecular formula C26H32N2
and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine.
Molecular Properties
| Compound Name | N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine |
| PubChem CID | 66993843 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine |
| SMILES | CCc1cccc(CC)c1-c1cc(C)c(CN(C)Cc2ccccc2)c(C)n1 |
| InChI | InChI=1S/C26H32N2/c1-6-22-14-11-15-23(7-2)26(22)25-16-19(3)24(20(4)27-25)18-28(5)17-21-12-9-8-10-13-21/h8-16H,6-7,17-18H2,1-5H3 |
| InChIKey | YFUNGKACZQDHSA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine?
The IUPAC name of N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine (CID 66993843) is N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine.
What is the SMILES notation for N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine?
The canonical SMILES for N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine is CCc1cccc(CC)c1-c1cc(C)c(CN(C)Cc2ccccc2)c(C)n1.
What is the InChIKey of N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine?
The InChIKey is YFUNGKACZQDHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2/c1-6-22-14-11-15-23(7-2)26(22)25-16-19(3)24(20(4)27-25)18-28(5)17-21-12-9-8-10-13-21/h8-16H,6-7,17-18H2,1-5H3.
What are the key properties of N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine?
N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine has a molecular weight of 372.56 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]-N-methyl-1-phenylmethanamine is sourced from PubChem (CID 66993843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).